C21H27IN4OS2 — CID 110060981
2-[2-(furan-2-yl)ethyl]-1-methyl-3-(2-phenylsulfanylethyl)-1-[2-(1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 110060981) has the molecular formula C21H27IN4OS2 and a molecular weight of 542.51 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)ethyl]-1-methyl-3-(2-phenylsulfanylethyl)-1-[2-(1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(furan-2-yl)ethyl]-1-methyl-3-(2-phenylsulfanylethyl)-1-[2-(1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110060981 |
| Molecular Formula | C21H27IN4OS2 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 2-[2-(furan-2-yl)ethyl]-1-methyl-3-(2-phenylsulfanylethyl)-1-[2-(1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CN(CCc1nccs1)/C(=N\CCc1ccco1)NCCSc1ccccc1.I |
| InChI | InChI=1S/C21H26N4OS2.HI/c1-25(14-10-20-22-12-17-28-20)21(23-11-9-18-6-5-15-26-18)24-13-16-27-19-7-3-2-4-8-19;/h2-8,12,15,17H,9-11,13-14,16H2,1H3,(H,23,24);1H |
| InChIKey | FDBCHGWYQIIVLH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|