C16H25IN4OS — CID 110061725
3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 110061725) has the molecular formula C16H25IN4OS and a molecular weight of 448.37 g/mol. Its IUPAC name is 3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110061725 |
| Molecular Formula | C16H25IN4OS |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccco1)N(C)CC(C)c1nccs1.I |
| InChI | InChI=1S/C16H24N4OS.HI/c1-4-17-16(19-8-7-14-6-5-10-21-14)20(3)12-13(2)15-18-9-11-22-15;/h5-6,9-11,13H,4,7-8,12H2,1-3H3,(H,17,19);1H |
| InChIKey | XCBXZKGKNIEYDD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|