C19H29IN4O2S — CID 110061707
3-[2-(furan-2-yl)ethyl]-1-methyl-2-(oxolan-2-ylmethyl)-1-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide (PubChem CID 110061707) has the molecular formula C19H29IN4O2S and a molecular weight of 504.44 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)ethyl]-1-methyl-2-(oxolan-2-ylmethyl)-1-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 3-[2-(furan-2-yl)ethyl]-1-methyl-2-(oxolan-2-ylmethyl)-1-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110061707 |
| Molecular Formula | C19H29IN4O2S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 3-[2-(furan-2-yl)ethyl]-1-methyl-2-(oxolan-2-ylmethyl)-1-[2-(1,3-thiazol-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CC(CN(C)/C(=N/CC1CCCO1)NCCc1ccco1)c1nccs1.I |
| InChI | InChI=1S/C19H28N4O2S.HI/c1-15(18-20-9-12-26-18)14-23(2)19(22-13-17-6-4-11-25-17)21-8-7-16-5-3-10-24-16;/h3,5,9-10,12,15,17H,4,6-8,11,13-14H2,1-2H3,(H,21,22);1H |
| InChIKey | POUZCZXYXDGFRS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|