C23H33N3O4 — CID 111655406
1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-[2-(furan-2-yl)ethyl]-1-methyl-2-(oxolan-2-ylmethyl)guanidine (PubChem CID 111655406) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-[2-(furan-2-yl)ethyl]-1-methyl-2-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-[2-(furan-2-yl)ethyl]-1-methyl-2-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111655406 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 1-[(4,5-dimethoxy-2-methylphenyl)methyl]-3-[2-(furan-2-yl)ethyl]-1-methyl-2-(oxolan-2-ylmethyl)guanidine |
| SMILES | COc1cc(C)c(CN(C)/C(=N/CC2CCCO2)NCCc2ccco2)cc1OC |
| InChI | InChI=1S/C23H33N3O4/c1-17-13-21(27-3)22(28-4)14-18(17)16-26(2)23(25-15-20-8-6-12-30-20)24-10-9-19-7-5-11-29-19/h5,7,11,13-14,20H,6,8-10,12,15-16H2,1-4H3,(H,24,25) |
| InChIKey | IJCHVDVPKNGOEY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 68.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|