C17H21F3IN3O — CID 110061373
3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-[(3,4,5-trifluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 110061373) has the molecular formula C17H21F3IN3O and a molecular weight of 467.27 g/mol. Its IUPAC name is 3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-[(3,4,5-trifluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-[(3,4,5-trifluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110061373 |
| Molecular Formula | C17H21F3IN3O |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methyl-1-[(3,4,5-trifluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccco1)N(C)Cc1cc(F)c(F)c(F)c1.I |
| InChI | InChI=1S/C17H20F3N3O.HI/c1-3-21-17(22-7-6-13-5-4-8-24-13)23(2)11-12-9-14(18)16(20)15(19)10-12;/h4-5,8-10H,3,6-7,11H2,1-2H3,(H,21,22);1H |
| InChIKey | SGQNUOVDFUMQIK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|