C16H19ClFN3O — CID 110061124
1-[(4-chloro-3-fluorophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-1,2-dimethylguanidine (PubChem CID 110061124) has the molecular formula C16H19ClFN3O and a molecular weight of 323.80 g/mol. Its IUPAC name is 1-[(4-chloro-3-fluorophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(4-chloro-3-fluorophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 110061124 |
| Molecular Formula | C16H19ClFN3O |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-[(4-chloro-3-fluorophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCc1ccco1)N(C)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H19ClFN3O/c1-19-16(20-8-7-13-4-3-9-22-13)21(2)11-12-5-6-14(17)15(18)10-12/h3-6,9-10H,7-8,11H2,1-2H3,(H,19,20) |
| InChIKey | FOHVVTWDVXXPDJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|