C19H25Cl2IN4O2 — CID 110053525
2-[[[(3,4-dichlorophenyl)methyl-methylamino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110053525) has the molecular formula C19H25Cl2IN4O2 and a molecular weight of 539.25 g/mol. Its IUPAC name is 2-[[[(3,4-dichlorophenyl)methyl-methylamino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(3,4-dichlorophenyl)methyl-methylamino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110053525 |
| Molecular Formula | C19H25Cl2IN4O2 |
| Molecular Weight | 539.25 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | 2-[[[(3,4-dichlorophenyl)methyl-methylamino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCc1ccco1)N(C)Cc1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C19H24Cl2N4O2.HI/c1-24(2)18(26)12-23-19(22-9-8-15-5-4-10-27-15)25(3)13-14-6-7-16(20)17(21)11-14;/h4-7,10-11H,8-9,12-13H2,1-3H3,(H,22,23);1H |
| InChIKey | JHWFJRWFDLXJIO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|