C19H26FN3O3 — CID 110053662
1-[(3-fluoro-4-methoxyphenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)-1-methylguanidine (PubChem CID 110053662) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)-1-methylguanidine.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)-1-methylguanidine |
|---|---|
| PubChem CID | 110053662 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)-1-methylguanidine |
| SMILES | COCC/N=C(\NCCc1ccco1)N(C)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C19H26FN3O3/c1-23(14-15-6-7-18(25-3)17(20)13-15)19(22-10-12-24-2)21-9-8-16-5-4-11-26-16/h4-7,11,13H,8-10,12,14H2,1-3H3,(H,21,22) |
| InChIKey | VNHOAQHFZBNBDX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|