C17H31IN4O3 — CID 110053761
N-tert-butyl-2-[[N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)carbamimidoyl]-methylamino]acetamide;hydroiodide (PubChem CID 110053761) has the molecular formula C17H31IN4O3 and a molecular weight of 466.36 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)carbamimidoyl]-methylamino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110053761 |
| Molecular Formula | C17H31IN4O3 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-tert-butyl-2-[[N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)carbamimidoyl]-methylamino]acetamide;hydroiodide |
| SMILES | COCC/N=C(/NCCc1ccco1)N(C)CC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C17H30N4O3.HI/c1-17(2,3)20-15(22)13-21(4)16(19-10-12-23-5)18-9-8-14-7-6-11-24-14;/h6-7,11H,8-10,12-13H2,1-5H3,(H,18,19)(H,20,22);1H |
| InChIKey | RLBJYLYYTMMMOG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|