C10H17N3O2 — CID 110913806
1-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine (PubChem CID 110913806) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 110913806 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(2-methoxyethyl)guanidine |
| SMILES | COCC/N=C(\N)NCCc1ccco1 |
| InChI | InChI=1S/C10H17N3O2/c1-14-8-6-13-10(11)12-5-4-9-3-2-7-15-9/h2-3,7H,4-6,8H2,1H3,(H3,11,12,13) |
| InChIKey | ATJHODRYQHMBNA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|