C23H34N4O4 — CID 110058636
tert-butyl N-[4-[2-[[N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]phenyl]carbamate (PubChem CID 110058636) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[[N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[[N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 110058636 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | tert-butyl N-[4-[2-[[N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]phenyl]carbamate |
| SMILES | COCC/N=C(/NCCc1ccc(NC(=O)OC(C)(C)C)cc1)NCCc1ccco1 |
| InChI | InChI=1S/C23H34N4O4/c1-23(2,3)31-22(28)27-19-9-7-18(8-10-19)11-13-24-21(26-15-17-29-4)25-14-12-20-6-5-16-30-20/h5-10,16H,11-15,17H2,1-4H3,(H,27,28)(H2,24,25,26) |
| InChIKey | YBIGVWFCETWCOU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|