C22H32FIN4O3 — CID 110053685
4-[(3-fluoro-4-methoxyphenyl)methyl]-N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 110053685) has the molecular formula C22H32FIN4O3 and a molecular weight of 546.43 g/mol. Its IUPAC name is 4-[(3-fluoro-4-methoxyphenyl)methyl]-N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(3-fluoro-4-methoxyphenyl)methyl]-N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110053685 |
| Molecular Formula | C22H32FIN4O3 |
| Molecular Weight | 546.43 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 4-[(3-fluoro-4-methoxyphenyl)methyl]-N-[2-(furan-2-yl)ethyl]-N'-(2-methoxyethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | COCC/N=C(\NCCc1ccco1)N1CCN(Cc2ccc(OC)c(F)c2)CC1.I |
| InChI | InChI=1S/C22H31FN4O3.HI/c1-28-15-9-25-22(24-8-7-19-4-3-14-30-19)27-12-10-26(11-13-27)17-18-5-6-21(29-2)20(23)16-18;/h3-6,14,16H,7-13,15,17H2,1-2H3,(H,24,25);1H |
| InChIKey | YZYKDHAVFXCZTP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|