C15H23ClIN5O — CID 110061483
1-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methylguanidine;hydroiodide (PubChem CID 110061483) has the molecular formula C15H23ClIN5O and a molecular weight of 451.74 g/mol. Its IUPAC name is 1-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110061483 |
| Molecular Formula | C15H23ClIN5O |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 1-[(5-chloro-1-methylimidazol-2-yl)methyl]-3-ethyl-2-[2-(furan-2-yl)ethyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccco1)N(C)Cc1ncc(Cl)n1C.I |
| InChI | InChI=1S/C15H22ClN5O.HI/c1-4-17-15(18-8-7-12-6-5-9-22-12)20(2)11-14-19-10-13(16)21(14)3;/h5-6,9-10H,4,7-8,11H2,1-3H3,(H,17,18);1H |
| InChIKey | QEYXIUJYRFVNCJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|