C18H33ClIN7O2 — CID 110049901
2-[[[(5-chloro-1-methylimidazol-2-yl)methyl-methylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110049901) has the molecular formula C18H33ClIN7O2 and a molecular weight of 541.87 g/mol. Its IUPAC name is 2-[[[(5-chloro-1-methylimidazol-2-yl)methyl-methylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(5-chloro-1-methylimidazol-2-yl)methyl-methylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110049901 |
| Molecular Formula | C18H33ClIN7O2 |
| Molecular Weight | 541.87 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 2-[[[(5-chloro-1-methylimidazol-2-yl)methyl-methylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(/NCCCN1CCOCC1)N(C)Cc1ncc(Cl)n1C.I |
| InChI | InChI=1S/C18H32ClN7O2.HI/c1-23(2)17(27)13-22-18(20-6-5-7-26-8-10-28-11-9-26)24(3)14-16-21-12-15(19)25(16)4;/h12H,5-11,13-14H2,1-4H3,(H,20,22);1H |
| InChIKey | SUVDZUGZGMHPAF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.87 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|