C13H19NO4S2 — CID 74238584
N-[3-(furan-2-ylmethylsulfanyl)propyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 74238584) has the molecular formula C13H19NO4S2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethylsulfanyl)propyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[3-(furan-2-ylmethylsulfanyl)propyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 74238584 |
| Molecular Formula | C13H19NO4S2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-[3-(furan-2-ylmethylsulfanyl)propyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(NCCCSCc1ccco1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H19NO4S2/c15-13(11-4-8-20(16,17)10-11)14-5-2-7-19-9-12-3-1-6-18-12/h1,3,6,11H,2,4-5,7-10H2,(H,14,15) |
| InChIKey | SMYKYRGLMPHACR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|