C20H29N3O2 — CID 95284457
(3R)-3-N-[[1-(3-methylphenyl)cyclopentyl]methyl]piperidine-1,3-dicarboxamide (PubChem CID 95284457) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (3R)-3-N-[[1-(3-methylphenyl)cyclopentyl]methyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[[1-(3-methylphenyl)cyclopentyl]methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95284457 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (3R)-3-N-[[1-(3-methylphenyl)cyclopentyl]methyl]piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(C2(CNC(=O)[C@@H]3CCCN(C(N)=O)C3)CCCC2)c1 |
| InChI | InChI=1S/C20H29N3O2/c1-15-6-4-8-17(12-15)20(9-2-3-10-20)14-22-18(24)16-7-5-11-23(13-16)19(21)25/h4,6,8,12,16H,2-3,5,7,9-11,13-14H2,1H3,(H2,21,25)(H,22,24)/t16-/m1/s1 |
| InChIKey | XZBYNLNWPBHTCA-MRXNPFEDSA-N |
| XLogP | 2.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |