C24H30Cl2N2O3S2 — CID 92679558
(3S)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide (PubChem CID 92679558) has the molecular formula C24H30Cl2N2O3S2 and a molecular weight of 529.56 g/mol. Its IUPAC name is (3S)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92679558 |
| Molecular Formula | C24H30Cl2N2O3S2 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | (3S)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-1-(3-phenylpropylsulfonyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1ccc(Cl)c(Cl)c1)[C@H]1CCCN(S(=O)(=O)CCCc2ccccc2)C1 |
| InChI | InChI=1S/C24H30Cl2N2O3S2/c25-22-11-10-20(16-23(22)26)18-32-14-12-27-24(29)21-9-4-13-28(17-21)33(30,31)15-5-8-19-6-2-1-3-7-19/h1-3,6-7,10-11,16,21H,4-5,8-9,12-15,17-18H2,(H,27,29)/t21-/m0/s1 |
| InChIKey | RMKZMQAMTWRTOG-NRFANRHFSA-N |
| XLogP | 5.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|