C15H15Cl2N3S2 — CID 100598831
1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-3-pyridin-4-ylthiourea (PubChem CID 100598831) has the molecular formula C15H15Cl2N3S2 and a molecular weight of 372.35 g/mol. Its IUPAC name is 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-3-pyridin-4-ylthiourea.
| Compound Name | 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-3-pyridin-4-ylthiourea |
|---|---|
| PubChem CID | 100598831 |
| Molecular Formula | C15H15Cl2N3S2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-3-pyridin-4-ylthiourea |
| SMILES | S=C(NCCSCc1ccc(Cl)cc1Cl)Nc1ccncc1 |
| InChI | InChI=1S/C15H15Cl2N3S2/c16-12-2-1-11(14(17)9-12)10-22-8-7-19-15(21)20-13-3-5-18-6-4-13/h1-6,9H,7-8,10H2,(H2,18,19,20,21) |
| InChIKey | HKYAIFFKURWAHY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|