C19H22Cl2N2OS2 — CID 100598612
1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(4-propan-2-yloxyphenyl)thiourea (PubChem CID 100598612) has the molecular formula C19H22Cl2N2OS2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(4-propan-2-yloxyphenyl)thiourea.
| Compound Name | 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(4-propan-2-yloxyphenyl)thiourea |
|---|---|
| PubChem CID | 100598612 |
| Molecular Formula | C19H22Cl2N2OS2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 1-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]-3-(4-propan-2-yloxyphenyl)thiourea |
| SMILES | CC(C)Oc1ccc(NC(=S)NCCSCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2OS2/c1-13(2)24-17-7-5-16(6-8-17)23-19(25)22-9-10-26-12-14-3-4-15(20)11-18(14)21/h3-8,11,13H,9-10,12H2,1-2H3,(H2,22,23,25) |
| InChIKey | WALVHCPLJCPLCF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|