C19H22ClFN2OS — CID 100681637
1-(3-chloro-4-fluorophenyl)-3-[3-(4-propan-2-yloxyphenyl)propyl]thiourea (PubChem CID 100681637) has the molecular formula C19H22ClFN2OS and a molecular weight of 380.92 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[3-(4-propan-2-yloxyphenyl)propyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[3-(4-propan-2-yloxyphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100681637 |
| Molecular Formula | C19H22ClFN2OS |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[3-(4-propan-2-yloxyphenyl)propyl]thiourea |
| SMILES | CC(C)Oc1ccc(CCCNC(=S)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22ClFN2OS/c1-13(2)24-16-8-5-14(6-9-16)4-3-11-22-19(25)23-15-7-10-18(21)17(20)12-15/h5-10,12-13H,3-4,11H2,1-2H3,(H2,22,23,25) |
| InChIKey | VUXVIPGJNKELIJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|