C16H18ClN3S2 — CID 100587483
1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-(4-methyl-2-pyridinyl)thiourea (PubChem CID 100587483) has the molecular formula C16H18ClN3S2 and a molecular weight of 351.93 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-(4-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-(4-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100587483 |
| Molecular Formula | C16H18ClN3S2 |
| Molecular Weight | 351.93 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]-3-(4-methyl-2-pyridinyl)thiourea |
| SMILES | Cc1ccnc(NC(=S)NCCSCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H18ClN3S2/c1-12-6-7-18-15(10-12)20-16(21)19-8-9-22-11-13-4-2-3-5-14(13)17/h2-7,10H,8-9,11H2,1H3,(H2,18,19,20,21) |
| InChIKey | GLHKCCKJGUFWGS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|