C16H16BrClN2OS — CID 100634270
1-(4-bromo-3-chlorophenyl)-3-[(2-ethoxyphenyl)methyl]thiourea (PubChem CID 100634270) has the molecular formula C16H16BrClN2OS and a molecular weight of 399.74 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-[(2-ethoxyphenyl)methyl]thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-[(2-ethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100634270 |
| Molecular Formula | C16H16BrClN2OS |
| Molecular Weight | 399.74 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-[(2-ethoxyphenyl)methyl]thiourea |
| SMILES | CCOc1ccccc1CNC(=S)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C16H16BrClN2OS/c1-2-21-15-6-4-3-5-11(15)10-19-16(22)20-12-7-8-13(17)14(18)9-12/h3-9H,2,10H2,1H3,(H2,19,20,22) |
| InChIKey | NUWHLODCFOESQO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.74 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|