C21H26N2OS — CID 2209954
1-(4-acetylphenyl)-3-[(1R)-1-(4-tert-butylphenyl)ethyl]thiourea (PubChem CID 2209954) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[(1R)-1-(4-tert-butylphenyl)ethyl]thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-[(1R)-1-(4-tert-butylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 2209954 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[(1R)-1-(4-tert-butylphenyl)ethyl]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)N[C@H](C)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26N2OS/c1-14(16-6-10-18(11-7-16)21(3,4)5)22-20(25)23-19-12-8-17(9-13-19)15(2)24/h6-14H,1-5H3,(H2,22,23,25)/t14-/m1/s1 |
| InChIKey | TUZQHHZNYZIMKT-CQSZACIVSA-N |
| XLogP | 5.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|