C19H18FN5S — CID 100565983
1-benzyl-3-[4-(4-fluoroanilino)-6-methylpyrimidin-2-yl]thiourea (PubChem CID 100565983) has the molecular formula C19H18FN5S and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-benzyl-3-[4-(4-fluoroanilino)-6-methylpyrimidin-2-yl]thiourea.
| Compound Name | 1-benzyl-3-[4-(4-fluoroanilino)-6-methylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100565983 |
| Molecular Formula | C19H18FN5S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-benzyl-3-[4-(4-fluoroanilino)-6-methylpyrimidin-2-yl]thiourea |
| SMILES | Cc1cc(Nc2ccc(F)cc2)nc(NC(=S)NCc2ccccc2)n1 |
| InChI | InChI=1S/C19H18FN5S/c1-13-11-17(23-16-9-7-15(20)8-10-16)24-18(22-13)25-19(26)21-12-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H3,21,22,23,24,25,26) |
| InChIKey | NEKFAKJIYIEKGF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|