C17H20ClN5O3 — CID 135516406
N-[(E)-N-(4-chloro-2,5-dimethoxyphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]acetamide (PubChem CID 135516406) has the molecular formula C17H20ClN5O3 and a molecular weight of 377.83 g/mol. Its IUPAC name is N-[(E)-N-(4-chloro-2,5-dimethoxyphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]acetamide.
| Compound Name | N-[(E)-N-(4-chloro-2,5-dimethoxyphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 135516406 |
| Molecular Formula | C17H20ClN5O3 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[(E)-N-(4-chloro-2,5-dimethoxyphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]acetamide |
| SMILES | COc1cc(N/C(=N\c2nc(C)cc(C)n2)NC(C)=O)c(OC)cc1Cl |
| InChI | InChI=1S/C17H20ClN5O3/c1-9-6-10(2)20-16(19-9)23-17(21-11(3)24)22-13-8-14(25-4)12(18)7-15(13)26-5/h6-8H,1-5H3,(H2,19,20,21,22,23,24) |
| InChIKey | FHMXUNDLVLVVIA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|