C15H17ClN4OS — CID 100785748
1-(4-chloro-6-methoxypyrimidin-2-yl)-3-(3-phenylpropyl)thiourea (PubChem CID 100785748) has the molecular formula C15H17ClN4OS and a molecular weight of 336.85 g/mol. Its IUPAC name is 1-(4-chloro-6-methoxypyrimidin-2-yl)-3-(3-phenylpropyl)thiourea.
| Compound Name | 1-(4-chloro-6-methoxypyrimidin-2-yl)-3-(3-phenylpropyl)thiourea |
|---|---|
| PubChem CID | 100785748 |
| Molecular Formula | C15H17ClN4OS |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-(4-chloro-6-methoxypyrimidin-2-yl)-3-(3-phenylpropyl)thiourea |
| SMILES | COc1cc(Cl)nc(NC(=S)NCCCc2ccccc2)n1 |
| InChI | InChI=1S/C15H17ClN4OS/c1-21-13-10-12(16)18-14(19-13)20-15(22)17-9-5-8-11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3,(H2,17,18,19,20,22) |
| InChIKey | BLVBFSDPHVGUGQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|