C18H15ClN4O4S — CID 15956642
5-(2-chlorophenyl)-N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 15956642) has the molecular formula C18H15ClN4O4S and a molecular weight of 418.86 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 15956642 |
| Molecular Formula | C18H15ClN4O4S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 5-(2-chlorophenyl)-N-[(4,6-dimethoxypyrimidin-2-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | COc1cc(OC)nc(NC(=S)NC(=O)c2ccc(-c3ccccc3Cl)o2)n1 |
| InChI | InChI=1S/C18H15ClN4O4S/c1-25-14-9-15(26-2)21-17(20-14)23-18(28)22-16(24)13-8-7-12(27-13)10-5-3-4-6-11(10)19/h3-9H,1-2H3,(H2,20,21,22,23,24,28) |
| InChIKey | NZZINNAQPNXOKA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|