C25H35FN6S — CID 100783434
1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 100783434) has the molecular formula C25H35FN6S and a molecular weight of 470.66 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100783434 |
| Molecular Formula | C25H35FN6S |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(3S,5S)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | C[C@H]1C[C@H](C)CN(c2cc(N3CCCCCC3)nc(NC(=S)NCc3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C25H35FN6S/c1-18-13-19(2)17-32(16-18)23-14-22(31-11-5-3-4-6-12-31)28-24(29-23)30-25(33)27-15-20-7-9-21(26)10-8-20/h7-10,14,18-19H,3-6,11-13,15-17H2,1-2H3,(H2,27,28,29,30,33)/t18-,19-/m0/s1 |
| InChIKey | QUZBQBVHXMNBFX-OALUTQOASA-N |
| XLogP | 4.97 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|