C24H33ClN6S — CID 125047061
1-[(4-chlorophenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 125047061) has the molecular formula C24H33ClN6S and a molecular weight of 473.09 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 125047061 |
| Molecular Formula | C24H33ClN6S |
| Molecular Weight | 473.09 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-[(2S)-2-methylpiperidin-1-yl]-6-[(3S)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1CCCN(c2cc(N3CCCC[C@@H]3C)nc(NC(=S)NCc3ccc(Cl)cc3)n2)C1 |
| InChI | InChI=1S/C24H33ClN6S/c1-17-6-5-12-30(16-17)21-14-22(31-13-4-3-7-18(31)2)28-23(27-21)29-24(32)26-15-19-8-10-20(25)11-9-19/h8-11,14,17-18H,3-7,12-13,15-16H2,1-2H3,(H2,26,27,28,29,32)/t17-,18-/m0/s1 |
| InChIKey | WSKNFBCTKZATRU-ROUUACIJSA-N |
| XLogP | 5.23 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.09 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|