C22H32N6OS — CID 125046271
1-(furan-2-ylmethyl)-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 125046271) has the molecular formula C22H32N6OS and a molecular weight of 428.61 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 125046271 |
| Molecular Formula | C22H32N6OS |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[4-[(2R)-2-methylpiperidin-1-yl]-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCCC[C@H]3C)nc(NC(=S)NCc3ccco3)n2)C1 |
| InChI | InChI=1S/C22H32N6OS/c1-16-7-5-10-27(15-16)19-13-20(28-11-4-3-8-17(28)2)25-21(24-19)26-22(30)23-14-18-9-6-12-29-18/h6,9,12-13,16-17H,3-5,7-8,10-11,14-15H2,1-2H3,(H2,23,24,25,26,30)/t16-,17-/m1/s1 |
| InChIKey | LZJNKTNLMJDSQH-IAGOWNOFSA-N |
| XLogP | 4.17 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|