C15H18ClN5O2S — CID 100779277
1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-[(5-methylfuran-2-yl)methyl]thiourea (PubChem CID 100779277) has the molecular formula C15H18ClN5O2S and a molecular weight of 367.86 g/mol. Its IUPAC name is 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-[(5-methylfuran-2-yl)methyl]thiourea.
| Compound Name | 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-[(5-methylfuran-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100779277 |
| Molecular Formula | C15H18ClN5O2S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)-3-[(5-methylfuran-2-yl)methyl]thiourea |
| SMILES | Cc1ccc(CNC(=S)Nc2nc(Cl)cc(N3CCOCC3)n2)o1 |
| InChI | InChI=1S/C15H18ClN5O2S/c1-10-2-3-11(23-10)9-17-15(24)20-14-18-12(16)8-13(19-14)21-4-6-22-7-5-21/h2-3,8H,4-7,9H2,1H3,(H2,17,18,19,20,24) |
| InChIKey | DYIALKSOLZONOM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|