C35H38N6OS — CID 100789392
1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 100789392) has the molecular formula C35H38N6OS and a molecular weight of 590.80 g/mol. Its IUPAC name is 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100789392 |
| Molecular Formula | C35H38N6OS |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 1-[4,6-bis(3,4-dihydro-1H-isoquinolin-2-yl)pyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | S=C(NCC1(c2ccccc2)CCOCC1)Nc1nc(N2CCc3ccccc3C2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C35H38N6OS/c43-34(36-25-35(16-20-42-21-17-35)30-12-2-1-3-13-30)39-33-37-31(40-18-14-26-8-4-6-10-28(26)23-40)22-32(38-33)41-19-15-27-9-5-7-11-29(27)24-41/h1-13,22H,14-21,23-25H2,(H2,36,37,38,39,43) |
| InChIKey | OSEITMVHJWUJOT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|