C32H39ClN6S — CID 100788214
1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100788214) has the molecular formula C32H39ClN6S and a molecular weight of 575.23 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100788214 |
| Molecular Formula | C32H39ClN6S |
| Molecular Weight | 575.23 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclohexyl]methyl]-3-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-piperidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | S=C(NCC1(c2ccc(Cl)cc2)CCCCC1)Nc1nc(N2CCCCC2)cc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C32H39ClN6S/c33-27-13-11-26(12-14-27)32(16-5-1-6-17-32)23-34-31(40)37-30-35-28(38-18-7-2-8-19-38)21-29(36-30)39-20-15-24-9-3-4-10-25(24)22-39/h3-4,9-14,21H,1-2,5-8,15-20,22-23H2,(H2,34,35,36,37,40) |
| InChIKey | GSDZFGNWUTUADB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.23 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|