C27H33N7OS2 — CID 100789371
1-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea (PubChem CID 100789371) has the molecular formula C27H33N7OS2 and a molecular weight of 535.74 g/mol. Its IUPAC name is 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea.
| Compound Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 100789371 |
| Molecular Formula | C27H33N7OS2 |
| Molecular Weight | 535.74 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 1-[4-[(2S)-2-methylpiperidin-1-yl]-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl]-3-[(4-phenyloxan-4-yl)methyl]thiourea |
| SMILES | C[C@H]1CCCCN1c1cc(Sc2ncccn2)nc(NC(=S)NCC2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C27H33N7OS2/c1-20-8-5-6-15-34(20)22-18-23(37-26-28-13-7-14-29-26)32-24(31-22)33-25(36)30-19-27(11-16-35-17-12-27)21-9-3-2-4-10-21/h2-4,7,9-10,13-14,18,20H,5-6,8,11-12,15-17,19H2,1H3,(H2,30,31,32,33,36)/t20-/m0/s1 |
| InChIKey | ZPVKVVDKNSXKSF-FQEVSTJZSA-N |
| XLogP | 4.83 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.74 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|