C15H20F3N5S — CID 100790591
1-[4-(azepan-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-cyclopropylthiourea (PubChem CID 100790591) has the molecular formula C15H20F3N5S and a molecular weight of 359.42 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-cyclopropylthiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 100790591 |
| Molecular Formula | C15H20F3N5S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]-3-cyclopropylthiourea |
| SMILES | FC(F)(F)c1cc(N2CCCCCC2)nc(NC(=S)NC2CC2)n1 |
| InChI | InChI=1S/C15H20F3N5S/c16-15(17,18)11-9-12(23-7-3-1-2-4-8-23)21-13(20-11)22-14(24)19-10-5-6-10/h9-10H,1-8H2,(H2,19,20,21,22,24) |
| InChIKey | XWOAGCRGOVDVJY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|