C16H24F3N5S — CID 133254321
1-tert-butyl-3-[4-(3-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea (PubChem CID 133254321) has the molecular formula C16H24F3N5S and a molecular weight of 375.46 g/mol. Its IUPAC name is 1-tert-butyl-3-[4-(3-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea.
| Compound Name | 1-tert-butyl-3-[4-(3-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 133254321 |
| Molecular Formula | C16H24F3N5S |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-tert-butyl-3-[4-(3-methylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]thiourea |
| SMILES | CC1CCCN(c2cc(C(F)(F)F)nc(NC(=S)NC(C)(C)C)n2)C1 |
| InChI | InChI=1S/C16H24F3N5S/c1-10-6-5-7-24(9-10)12-8-11(16(17,18)19)20-13(21-12)22-14(25)23-15(2,3)4/h8,10H,5-7,9H2,1-4H3,(H2,20,21,22,23,25) |
| InChIKey | BRMNMHIHQKPYKD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|