C15H22ClN5S — CID 100780615
1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-prop-2-enylthiourea (PubChem CID 100780615) has the molecular formula C15H22ClN5S and a molecular weight of 339.90 g/mol. Its IUPAC name is 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 100780615 |
| Molecular Formula | C15H22ClN5S |
| Molecular Weight | 339.90 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-[4-chloro-6-[(3R,5R)-3,5-dimethylpiperidin-1-yl]pyrimidin-2-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1nc(Cl)cc(N2C[C@H](C)C[C@@H](C)C2)n1 |
| InChI | InChI=1S/C15H22ClN5S/c1-4-5-17-15(22)20-14-18-12(16)7-13(19-14)21-8-10(2)6-11(3)9-21/h4,7,10-11H,1,5-6,8-9H2,2-3H3,(H2,17,18,19,20,22)/t10-,11-/m1/s1 |
| InChIKey | LFBGLJQYTUKHGT-GHMZBOCLSA-N |
| XLogP | 3.08 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|