C26H30N6S — CID 100780825
1-benzyl-3-[4-(1,3-dihydroisoindol-2-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea (PubChem CID 100780825) has the molecular formula C26H30N6S and a molecular weight of 458.64 g/mol. Its IUPAC name is 1-benzyl-3-[4-(1,3-dihydroisoindol-2-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea.
| Compound Name | 1-benzyl-3-[4-(1,3-dihydroisoindol-2-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100780825 |
| Molecular Formula | C26H30N6S |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 1-benzyl-3-[4-(1,3-dihydroisoindol-2-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3Cc4ccccc4C3)nc(NC(=S)NCc3ccccc3)n2)C1 |
| InChI | InChI=1S/C26H30N6S/c1-19-8-7-13-31(16-19)23-14-24(32-17-21-11-5-6-12-22(21)18-32)29-25(28-23)30-26(33)27-15-20-9-3-2-4-10-20/h2-6,9-12,14,19H,7-8,13,15-18H2,1H3,(H2,27,28,29,30,33)/t19-/m1/s1 |
| InChIKey | KMZIURLSJTVJAC-LJQANCHMSA-N |
| XLogP | 4.72 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|