C26H31N7S — CID 100782362
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea (PubChem CID 100782362) has the molecular formula C26H31N7S and a molecular weight of 473.65 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100782362 |
| Molecular Formula | C26H31N7S |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(pyridin-3-ylmethyl)thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCc4ccccc4C3)nc(NC(=S)NCc3cccnc3)n2)C1 |
| InChI | InChI=1S/C26H31N7S/c1-19-6-5-12-32(17-19)23-14-24(33-13-10-21-8-2-3-9-22(21)18-33)30-25(29-23)31-26(34)28-16-20-7-4-11-27-15-20/h2-4,7-9,11,14-15,19H,5-6,10,12-13,16-18H2,1H3,(H2,28,29,30,31,34)/t19-/m1/s1 |
| InChIKey | GCHSEDJMWROVJI-LJQANCHMSA-N |
| XLogP | 4.16 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|