C25H34N6O2S — CID 100791536
1-[4-(azepan-1-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(1,3-benzodioxol-5-ylmethyl)thiourea (PubChem CID 100791536) has the molecular formula C25H34N6O2S and a molecular weight of 482.65 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(1,3-benzodioxol-5-ylmethyl)thiourea.
| Compound Name | 1-[4-(azepan-1-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(1,3-benzodioxol-5-ylmethyl)thiourea |
|---|---|
| PubChem CID | 100791536 |
| Molecular Formula | C25H34N6O2S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 1-[4-(azepan-1-yl)-6-[(3R)-3-methylpiperidin-1-yl]pyrimidin-2-yl]-3-(1,3-benzodioxol-5-ylmethyl)thiourea |
| SMILES | C[C@@H]1CCCN(c2cc(N3CCCCCC3)nc(NC(=S)NCc3ccc4c(c3)OCO4)n2)C1 |
| InChI | InChI=1S/C25H34N6O2S/c1-18-7-6-12-31(16-18)23-14-22(30-10-4-2-3-5-11-30)27-24(28-23)29-25(34)26-15-19-8-9-20-21(13-19)33-17-32-20/h8-9,13-14,18H,2-7,10-12,15-17H2,1H3,(H2,26,27,28,29,34)/t18-/m1/s1 |
| InChIKey | AHVLOLVCEJCDDF-GOSISDBHSA-N |
| XLogP | 4.31 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|