C24H32N6O2S — CID 100791723
1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea (PubChem CID 100791723) has the molecular formula C24H32N6O2S and a molecular weight of 468.63 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 100791723 |
| Molecular Formula | C24H32N6O2S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[4-[(3S)-3-methylpiperidin-1-yl]-6-pyrrolidin-1-ylpyrimidin-2-yl]thiourea |
| SMILES | C[C@H]1CCCN(c2cc(N3CCCC3)nc(NC(=S)NCc3ccc4c(c3)OCCO4)n2)C1 |
| InChI | InChI=1S/C24H32N6O2S/c1-17-5-4-10-30(16-17)22-14-21(29-8-2-3-9-29)26-23(27-22)28-24(33)25-15-18-6-7-19-20(13-18)32-12-11-31-19/h6-7,13-14,17H,2-5,8-12,15-16H2,1H3,(H2,25,26,27,28,33)/t17-/m0/s1 |
| InChIKey | NYENPLZIIVPVJM-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|