C15H18N6OS2 — CID 100790648
1-cyclopentyl-3-(4-methoxy-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea (PubChem CID 100790648) has the molecular formula C15H18N6OS2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-cyclopentyl-3-(4-methoxy-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea.
| Compound Name | 1-cyclopentyl-3-(4-methoxy-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100790648 |
| Molecular Formula | C15H18N6OS2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-cyclopentyl-3-(4-methoxy-6-pyrimidin-2-ylsulfanylpyrimidin-2-yl)thiourea |
| SMILES | COc1cc(Sc2ncccn2)nc(NC(=S)NC2CCCC2)n1 |
| InChI | InChI=1S/C15H18N6OS2/c1-22-11-9-12(24-15-16-7-4-8-17-15)20-13(19-11)21-14(23)18-10-5-2-3-6-10/h4,7-10H,2-3,5-6H2,1H3,(H2,18,19,20,21,23) |
| InChIKey | OYGVNDXFNAVISF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|