C22H28N2O2S — CID 100636414
1-(4-cyclopentyloxyphenyl)-3-[(4-propan-2-yloxyphenyl)methyl]thiourea (PubChem CID 100636414) has the molecular formula C22H28N2O2S and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[(4-propan-2-yloxyphenyl)methyl]thiourea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[(4-propan-2-yloxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100636414 |
| Molecular Formula | C22H28N2O2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[(4-propan-2-yloxyphenyl)methyl]thiourea |
| SMILES | CC(C)Oc1ccc(CNC(=S)Nc2ccc(OC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O2S/c1-16(2)25-20-11-7-17(8-12-20)15-23-22(27)24-18-9-13-21(14-10-18)26-19-5-3-4-6-19/h7-14,16,19H,3-6,15H2,1-2H3,(H2,23,24,27) |
| InChIKey | HYFMMOCLTSMMHL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|