C19H21FN2OS — CID 100763441
1-(4-cyclopentyloxyphenyl)-3-[(2-fluorophenyl)methyl]thiourea (PubChem CID 100763441) has the molecular formula C19H21FN2OS and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[(2-fluorophenyl)methyl]thiourea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[(2-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 100763441 |
| Molecular Formula | C19H21FN2OS |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[(2-fluorophenyl)methyl]thiourea |
| SMILES | Fc1ccccc1CNC(=S)Nc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C19H21FN2OS/c20-18-8-4-1-5-14(18)13-21-19(24)22-15-9-11-17(12-10-15)23-16-6-2-3-7-16/h1,4-5,8-12,16H,2-3,6-7,13H2,(H2,21,22,24) |
| InChIKey | YUIPQZFDPOAWJR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|