C26H34N2O2 — CID 133200328
N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide (PubChem CID 133200328) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide.
| Compound Name | N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide |
|---|---|
| PubChem CID | 133200328 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | N-[[4-(3-methylpiperidin-1-yl)phenyl]methyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide |
| SMILES | CC1CCCN(c2ccc(CNC(=O)C(C)Oc3ccc4c(c3)CCCC4)cc2)C1 |
| InChI | InChI=1S/C26H34N2O2/c1-19-6-5-15-28(18-19)24-12-9-21(10-13-24)17-27-26(29)20(2)30-25-14-11-22-7-3-4-8-23(22)16-25/h9-14,16,19-20H,3-8,15,17-18H2,1-2H3,(H,27,29) |
| InChIKey | FBUJKPIXJLNKRT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|