C29H27N3O4S — CID 19062457
N-[2-(benzylcarbamoyl)phenyl]-2-methyl-3-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 19062457) has the molecular formula C29H27N3O4S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-[2-(benzylcarbamoyl)phenyl]-2-methyl-3-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[2-(benzylcarbamoyl)phenyl]-2-methyl-3-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 19062457 |
| Molecular Formula | C29H27N3O4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | N-[2-(benzylcarbamoyl)phenyl]-2-methyl-3-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)Nc3ccccc3C(=O)NCc3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C29H27N3O4S/c1-20-15-17-23(18-16-20)37(35,36)32-26-14-8-12-24(21(26)2)29(34)31-27-13-7-6-11-25(27)28(33)30-19-22-9-4-3-5-10-22/h3-18,32H,19H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | ZGBOGCDSYRPCJT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |