C14H18ClNO3S — CID 43240680
3-[4-(4-chlorophenyl)sulfanylbutanoylamino]butanoic acid (PubChem CID 43240680) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)sulfanylbutanoylamino]butanoic acid.
| Compound Name | 3-[4-(4-chlorophenyl)sulfanylbutanoylamino]butanoic acid |
|---|---|
| PubChem CID | 43240680 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-[4-(4-chlorophenyl)sulfanylbutanoylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO3S/c1-10(9-14(18)19)16-13(17)3-2-8-20-12-6-4-11(15)5-7-12/h4-7,10H,2-3,8-9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | YGTGFMPPFIMVAV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|