C15H22ClNO2S2 — CID 103801328
4-(4-chlorophenyl)sulfanyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)butanamide (PubChem CID 103801328) has the molecular formula C15H22ClNO2S2 and a molecular weight of 347.93 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)butanamide |
|---|---|
| PubChem CID | 103801328 |
| Molecular Formula | C15H22ClNO2S2 |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)butanamide |
| SMILES | CSC(CO)C(C)NC(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClNO2S2/c1-11(14(10-18)20-2)17-15(19)4-3-9-21-13-7-5-12(16)6-8-13/h5-8,11,14,18H,3-4,9-10H2,1-2H3,(H,17,19) |
| InChIKey | ANHKCPNGMIGYIV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|