C14H20ClNO2S2 — CID 103801450
2-(4-chlorophenyl)sulfanyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)propanamide (PubChem CID 103801450) has the molecular formula C14H20ClNO2S2 and a molecular weight of 333.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)propanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 103801450 |
| Molecular Formula | C14H20ClNO2S2 |
| Molecular Weight | 333.91 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)propanamide |
| SMILES | CSC(CO)C(C)NC(=O)C(C)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClNO2S2/c1-9(13(8-17)19-3)16-14(18)10(2)20-12-6-4-11(15)5-7-12/h4-7,9-10,13,17H,8H2,1-3H3,(H,16,18) |
| InChIKey | HIVDRPUYDRHFQX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.91 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |