C13H22Cl2OSi2 — CID 155629440
dichloro-methyl-[1-(4-trimethylsilyloxyphenyl)propyl]silane (PubChem CID 155629440) has the molecular formula C13H22Cl2OSi2 and a molecular weight of 321.40 g/mol. Its IUPAC name is dichloro-methyl-[1-(4-trimethylsilyloxyphenyl)propyl]silane.
| Compound Name | dichloro-methyl-[1-(4-trimethylsilyloxyphenyl)propyl]silane |
|---|---|
| PubChem CID | 155629440 |
| Molecular Formula | C13H22Cl2OSi2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | dichloro-methyl-[1-(4-trimethylsilyloxyphenyl)propyl]silane |
| SMILES | CCC(c1ccc(O[Si](C)(C)C)cc1)[Si](C)(Cl)Cl |
| InChI | InChI=1S/C13H22Cl2OSi2/c1-6-13(18(5,14)15)11-7-9-12(10-8-11)16-17(2,3)4/h7-10,13H,6H2,1-5H3 |
| InChIKey | WELWXPYFHOFRTD-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|